Behind every deeply savory flavor you've ever tasted, this molecule is at work β the amino acid that gave the world umami.
Symbol
Glu Β· E
Discovered
1866
Mol. Weight
147.13 g/mol
Essential
No
E
Discovery: Out of Gluten
L-Glutamic Acid
In 1866, German chemist Karl Heinrich Ritthausen was systematically breaking down plant proteins β specifically, he was working with gluten, the protein complex found in wheat. He treated it with sulfuric acid (the standard hydrolysis method of the era) and isolated a new crystalline substance he called GlutaminsΓ€ure β glutamic acid β named directly after gluten.
The discovery was chemically straightforward but didn't attract much attention for four decades. That changed dramatically in 1908, not in Germany, but in Tokyo β thanks to a bowl of soup and a chemist with a very attentive palate.
π Tokyo, 1908: The Discovery of Umami
Kikunae Ikeda, a chemistry professor at Tokyo Imperial University, was eating a bowl of dashi β a Japanese broth made from kombu seaweed β when he noticed something that didn't fit. The broth had a distinctive, deeply savory quality that couldn't be explained by the four known tastes: sweet, sour, salty, and bitter. It was something else entirely.
Ikeda went to work. He extracted and concentrated kombu and eventually isolated the compound responsible: glutamic acid, in its salt form. He called the taste umami β from Japanese umai (delicious, savory) and mi (taste). He patented a method for producing the sodium salt of glutamic acid β monosodium glutamate, MSG β and by 1909, it was being sold commercially under the brand name Aji-no-moto: "essence of taste."
Identifiers and Properties of Glutamic Acid
Identity
IUPAC Name(2S)-2-Aminopentanedioic acid
FormulaCβ HβNOβ
Mol. Weight147.13 g/mol
CAS Number56-86-0
MDL NumberMFCD00002634
Physical
Melting point205 Β°C
Solubility7.5 g/L (20 Β°C)
pKaβ (Ξ±-COOH)2.10
pKaβ (NHββΊ)9.47
pKaR (R-COOH)4.07
pI3.08
Rf (BuOH/AcOH/HβO = 12:3:5)0.30
Identifiers
Canonical SMILESC(CC(=O)O)C(C(=O)O)N
Isomeric SMILESC(CC(=O)O)[C@@H](C(=O)O)N
InChIKeyWHUUTDBJXJRKMK-VKHMYHEASA-N
CategoryAcidic
Charge at pH 7Negative (β1)
Glutamate or Glutamic Acid?
The two terms are often used interchangeably, but there is a precise chemical distinction between them.
Glutamic acid is the neutral form β the molecule as it exists in dry powder or in proteins, with its carboxyl group intact (βCOOH). Glutamate is the ionized form: at physiological pH, the carboxyl group loses a proton and carries a negative charge (βCOOβ»). In the conditions inside a living cell or in solution, the conversion happens spontaneously β so for most biological discussions, the terms are functionally equivalent.
The distinction matters in some contexts: when discussing the amino acid as a component of proteins, "glutamic acid" is technically precise. When discussing the neurotransmitter in the brain, or the flavor compound in food and MSG, "glutamate" is the more common and appropriate term. When people refer to monosodium glutamate (MSG), they mean the sodium salt of glutamic acid β the same compound, stabilized in a shelf-stable form.
The Most Abundant Amino Acid
Glutamic acid has a claim few other amino acids can match: it is the most abundant amino acid in nature. In many common proteins, glutamate makes up 15β23% of all amino acid residues. It is particularly prevalent in wheat proteins β gluten is about 25% glutamic acid, which is fitting given that Ritthausen isolated it from gluten in the first place.
Its abundance isn't accidental. Glutamic acid plays a central role in metabolism β it sits at the intersection of protein synthesis and energy production. The citric acid cycle feeds directly into glutamate chemistry. Nearly every organism on Earth uses glutamate as a hub for amino acid metabolism, shuttling nitrogen between different compounds.
Umami: The Science of the Fifth Taste
For most of the twentieth century, Western science recognized only four primary tastes. Umami was a Japanese concept viewed with skepticism by many researchers. That changed in 2001 when scientists identified specific taste receptor proteins β metabotropic glutamate receptor 4 (mGluR4) and others β on the human tongue that respond specifically to glutamate. The fifth taste became scientifically undeniable.
What makes umami distinctive is partly its synergy with other compounds. Glutamate interacts powerfully with nucleotides like inosinate (IMP, found in meat) and guanylate (GMP, found in mushrooms) to create a taste that is more than the sum of its parts. This is why combining tomatoes with cheese, or meat with mushrooms, creates something more deeply satisfying than either ingredient alone β the compounds literally multiply each other's effect on taste receptors.
"Umami is not simply a strong version of saltiness or savoriness β it is a distinct taste sensation, now recognized by the scientific community as the fifth primary taste."
Functions of L-Glutamic Acid in the Body
Glutamic acid is a non-essential amino acid, synthesized by the body in sufficient quantities under normal conditions. It participates in a remarkably broad range of metabolic functions.
Excitatory neurotransmitter
Glutamate is the primary excitatory neurotransmitter in the vertebrate central nervous system. It is involved in learning, memory formation, and the regulation of virtually all major brain functions. Nearly every excitatory synapse in the brain uses glutamate as its signaling molecule. It acts on several receptor types, including NMDA, AMPA, and kainate receptors, each mediating different aspects of neural signaling.
GABA precursor
Glutamate is the direct metabolic precursor of gamma-aminobutyric acid (GABA) β the brain's primary inhibitory neurotransmitter. The enzyme glutamate decarboxylase converts glutamate to GABA in GABAergic neurons. The balance between glutamate (excitatory) and GABA (inhibitory) is fundamental to normal brain function; disruptions to this balance are implicated in epilepsy, anxiety disorders, and other neurological conditions.
Ammonia detoxification
In both the brain and peripheral tissues, glutamate plays a key role in removing toxic ammonia. In the brain, glutamate combines with ammonia to form glutamine β a reaction catalyzed by glutamine synthetase. This is the brain's primary mechanism for disposing of ammonia produced by nitrogen metabolism. Similarly, in muscle cells during intense exercise, rising ammonia levels are managed through the same conversion: glutamate accepts the ammonia and is transformed to glutamine, which is then safely transported to the liver.
Central role in the citric acid cycle
Glutamate is an important intermediate in the citric acid cycle (Krebs cycle) and plays a central role in carbohydrate metabolism. Through transamination reactions, glutamate transfers amino groups between different metabolic pathways, connecting amino acid catabolism to energy production. It is one of the most versatile amino acids in intermediary metabolism.
Did You Know?
When Kikunae Ikeda filed his patent for MSG in 1908, the description stated: "a condiment that imparts a savory taste." Today, umami is the fifth officially recognized primary taste β and glutamic acid is the molecule responsible.
Interesting Facts
π₯
Most abundant in nature. Glutamic acid is often the single most common amino acid in proteins β comprising up to 23% in some plant proteins. It is also the most commercially produced amino acid, with millions of tons manufactured annually, primarily by bacterial fermentation.
π§
The brain's primary excitatory messenger. Glutamate synthesized in the brain β not the dietary form β is the most important excitatory neurotransmitter in the vertebrate nervous system. It is involved in learning, memory, and virtually all major brain functions.
π§
MSG myth: thoroughly debunked. "Chinese Restaurant Syndrome" β the idea that MSG causes headaches β originated from a letter published in 1968. Decades of rigorous controlled studies have failed to find a causal link between MSG and any adverse effects in the general population under normal consumption conditions.
π«
Industrial production by fermentation. Most MSG is produced by bacterial fermentation, similar to how vinegar or yogurt are made. Corynebacterium glutamicum, specifically discovered and bred for this purpose, ferments sugars and converts them into glutamic acid. This discovery in 1956 launched the entire modern amino acid fermentation industry.
π
Why ripe tomatoes taste so good. As tomatoes ripen, free glutamate content increases dramatically β from about 5 mg per 100g in unripe tomatoes to over 50 mg per 100g when fully ripe. This is a large part of why a perfectly ripe summer tomato has such a complex, satisfying flavor.
High-Glutamate Foods: Where Umami Lives
Free glutamate β the form that activates taste receptors β is concentrated in fermented, aged, and dried foods. Bound glutamate in proteins doesn't contribute to taste until the protein is broken down by cooking, fermentation, or digestion: